C50H35IrN3-2 — CID 171043733
CID 171043733 (PubChem CID 171043733) has the molecular formula C50H35IrN3-2 and a molecular weight of 876.10 g/mol.
| Compound Name | CID 171043733 |
|---|---|
| PubChem CID | 171043733 |
| Molecular Formula | C50H35IrN3-2 |
| Molecular Weight | 876.10 g/mol |
| Exact Mass | 876.28 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[Ir].[c-]1ccc2cc1-c1nc3ccccc3n1-c1cccc(c1)-c1ccccc1-c1cccc(c1)-c1cccc-2c1 |
| InChI | InChI=1S/C37H23N2.C13H12N.Ir/c1-2-18-34-30-14-8-16-32(24-30)39-36-20-4-3-19-35(36)38-37(39)31-15-7-12-28(23-31)26-10-5-9-25(21-26)27-11-6-13-29(22-27)33(34)17-1;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h1-14,16-24H;3-6,8-9H,1-2H3;/q2*-1;/i;1D3,2D3; |
| InChIKey | DWASZEUFYQOKRV-RUHQGNAASA-N |
| XLogP | 12.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.10 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|