C42H40IrN4O-2 — CID 177294289
CID 177294289 (PubChem CID 177294289) has the molecular formula C42H40IrN4O-2 and a molecular weight of 809.03 g/mol.
| Compound Name | CID 177294289 |
|---|---|
| PubChem CID | 177294289 |
| Molecular Formula | C42H40IrN4O-2 |
| Molecular Weight | 809.03 g/mol |
| Exact Mass | 809.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc2c(c1)c1c([c-]cc3nc(C(C)(C)C)oc31)c1nc3ccccc3n21.Cc1c[c-]c(-c2cc(C)c(C)cn2)cc1.[Ir] |
| InChI | InChI=1S/C28H26N3O.C14H14N.Ir/c1-27(2,3)16-11-14-21-18(15-16)23-17(25-29-19-9-7-8-10-22(19)31(21)25)12-13-20-24(23)32-26(30-20)28(4,5)6;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h7-11,13-15H,1-6H3;4-6,8-9H,1-3H3;/q2*-1; |
| InChIKey | PCPDKVQZWSYAAB-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.03 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|