C45H31IrN3S-2 — CID 177294241
CID 177294241 (PubChem CID 177294241) has the molecular formula C45H31IrN3S-2 and a molecular weight of 847.10 g/mol.
| Compound Name | CID 177294241 |
|---|---|
| PubChem CID | 177294241 |
| Molecular Formula | C45H31IrN3S-2 |
| Molecular Weight | 847.10 g/mol |
| Exact Mass | 847.24 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cn2)cc1.[Ir].[c-]1cc2c3cccc(-c4ccccc4)c3sc2c2c1c1nc3ccccc3n1c1ccccc21 |
| InChI | InChI=1S/C31H17N2S.C14H14N.Ir/c1-2-9-19(10-3-1)20-12-8-13-21-22-17-18-24-28(30(22)34-29(20)21)23-11-4-6-15-26(23)33-27-16-7-5-14-25(27)32-31(24)33;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h1-17H;4-6,8-9H,1-3H3;/q2*-1;/i;1D3,2D3,3D3; |
| InChIKey | QYGQWBXJGPFTEO-YETZKOCPSA-N |
| XLogP | 12.10 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.10 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|