C54H49IrN3O-2 — CID 176753055
CID 176753055 (PubChem CID 176753055) has the molecular formula C54H49IrN3O-2 and a molecular weight of 957.28 g/mol.
| Compound Name | CID 176753055 |
|---|---|
| PubChem CID | 176753055 |
| Molecular Formula | C54H49IrN3O-2 |
| Molecular Weight | 957.28 g/mol |
| Exact Mass | 957.41 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccc3c(c2)oc2cc4c5ccc[c-]c5c5nc6ccccc6n5c4cc23)c(C(C)C)c1.[2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cn2)cc1.[Ir] |
| InChI | InChI=1S/C40H35N2O.C14H14N.Ir/c1-22(2)26-17-30(23(3)4)39(31(18-26)24(5)6)25-15-16-28-33-20-36-32(21-38(33)43-37(28)19-25)27-11-7-8-12-29(27)40-41-34-13-9-10-14-35(34)42(36)40;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h7-11,13-24H,1-6H3;4-6,8-9H,1-3H3;/q2*-1;/i;1D3,2D3,3D3; |
| InChIKey | BBISUABSZYEVBC-YETZKOCPSA-N |
| XLogP | 15.00 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.28 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|