About CID 176752922
CID 176752922 (PubChem CID 176752922) has the molecular formula C45H32IrN4-2
and a molecular weight of 830.05 g/mol.
Molecular Properties
| Compound Name | CID 176752922 |
| PubChem CID | 176752922 |
| Molecular Formula | C45H32IrN4-2 |
| Molecular Weight | 830.05 g/mol |
| Exact Mass | 830.28 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cn2)cc1.[Ir].[c-]1cccc2c1c1nc3ccccc3n1c1c2ccc2c3ccccc3n(-c3ccccc3)c21 |
| InChI | InChI=1S/C31H18N3.C14H14N.Ir/c1-2-10-20(11-3-1)33-27-16-8-6-13-22(27)24-19-18-23-21-12-4-5-14-25(21)31-32-26-15-7-9-17-28(26)34(31)30(23)29(24)33;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h1-13,15-19H;4-6,8-9H,1-3H3;/q2*-1;/i;1D3,2D3,3D3; |
| InChIKey | WFJREESDCRUPRG-YETZKOCPSA-N |
| XLogP | 11.16 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 830.05 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176752922 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176752922?
The IUPAC name of CID 176752922 (CID 176752922) is not available.
What is the SMILES notation for CID 176752922?
The canonical SMILES for CID 176752922 is [2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cn2)cc1.[Ir].[c-]1cccc2c1c1nc3ccccc3n1c1c2ccc2c3ccccc3n(-c3ccccc3)c21.
What is the InChIKey of CID 176752922?
The InChIKey is WFJREESDCRUPRG-YETZKOCPSA-N. The full InChI is InChI=1S/C31H18N3.C14H14N.Ir/c1-2-10-20(11-3-1)33-27-16-8-6-13-22(27)24-19-18-23-21-12-4-5-14-25(21)31-32-26-15-7-9-17-28(26)34(31)30(23)29(24)33;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h1-13,15-19H;4-6,8-9H,1-3H3;/q2*-1;/i;1D3,2D3,3D3;.
What are the key properties of CID 176752922?
CID 176752922 has a molecular weight of 830.05 g/mol, XLogP of 11.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176752922 is sourced from PubChem (CID 176752922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).