C38H28IrN4O-2 — CID 176753049
CID 176753049 (PubChem CID 176753049) has the molecular formula C38H28IrN4O-2 and a molecular weight of 751.90 g/mol.
| Compound Name | CID 176753049 |
|---|---|
| PubChem CID | 176753049 |
| Molecular Formula | C38H28IrN4O-2 |
| Molecular Weight | 751.90 g/mol |
| Exact Mass | 752.21 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1C(C)(C)C.[C-]#[N+]c1cccc2oc3c4ccc[c-]c4c4nc5ccccc5n4c3c12.[Ir] |
| InChI | InChI=1S/C22H10N3O.C16H18N.Ir/c1-23-16-10-6-12-18-19(16)20-21(26-18)13-7-2-3-8-14(13)22-24-15-9-4-5-11-17(15)25(20)22;1-12-11-17-15(10-14(12)16(2,3)4)13-8-6-5-7-9-13;/h2-7,9-12H;5-8,10-11H,1-4H3;/q2*-1;/i;1D3; |
| InChIKey | ZEPTYBHQMCKJGF-ICMJTWPQSA-N |
| XLogP | 10.04 |
| TPSA | 47.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.90 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|