About CID 177303095
CID 177303095 (PubChem CID 177303095) has the molecular formula C66H57IrN3O-2
and a molecular weight of 1106.46 g/mol.
Molecular Properties
| Compound Name | CID 177303095 |
| PubChem CID | 177303095 |
| Molecular Formula | C66H57IrN3O-2 |
| Molecular Weight | 1106.46 g/mol |
| Exact Mass | 1106.45 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2nc3ccc4ccccc4c3n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2oc3cc4ccc5ccccc5c4cc3c12.[2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1C(C)(C)C.[Ir] |
| InChI | InChI=1S/C50H39N2O.C16H18N.Ir/c1-29(2)40-25-36(32-13-7-6-8-14-32)26-41(30(3)4)47(40)52-48-38-18-12-10-16-34(38)22-24-44(48)51-50(52)39-23-19-31(5)46-43-28-42-35(27-45(43)53-49(39)46)21-20-33-15-9-11-17-37(33)42;1-12-11-17-15(10-14(12)16(2,3)4)13-8-6-5-7-9-13;/h6-22,24-30H,1-5H3;5-8,10-11H,1-4H3;/q2*-1;/i5D3;1D3; |
| InChIKey | VBKUQKZKZJEZFK-CRFOFUJUSA-N |
| XLogP | 18.23 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1106.46 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 177303095 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177303095?
The IUPAC name of CID 177303095 (CID 177303095) is not available.
What is the SMILES notation for CID 177303095?
The canonical SMILES for CID 177303095 is [2H]C([2H])([2H])c1c[c-]c(-c2nc3ccc4ccccc4c3n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2oc3cc4ccc5ccccc5c4cc3c12.[2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1C(C)(C)C.[Ir].
What is the InChIKey of CID 177303095?
The InChIKey is VBKUQKZKZJEZFK-CRFOFUJUSA-N. The full InChI is InChI=1S/C50H39N2O.C16H18N.Ir/c1-29(2)40-25-36(32-13-7-6-8-14-32)26-41(30(3)4)47(40)52-48-38-18-12-10-16-34(38)22-24-44(48)51-50(52)39-23-19-31(5)46-43-28-42-35(27-45(43)53-49(39)46)21-20-33-15-9-11-17-37(33)42;1-12-11-17-15(10-14(12)16(2,3)4)13-8-6-5-7-9-13;/h6-22,24-30H,1-5H3;5-8,10-11H,1-4H3;/q2*-1;/i5D3;1D3;.
What are the key properties of CID 177303095?
CID 177303095 has a molecular weight of 1106.46 g/mol, XLogP of 18.23, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177303095 is sourced from PubChem (CID 177303095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).