C50H40N2O — CID 177303045
1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[5-(trideuteriomethyl)-10-oxapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaen-8-yl]benzo[e]benzimidazole (PubChem CID 177303045) has the molecular formula C50H40N2O and a molecular weight of 687.90 g/mol. Its IUPAC name is 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[5-(trideuteriomethyl)-10-oxapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaen-8-yl]benzo[e]benzimidazole.
| Compound Name | 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[5-(trideuteriomethyl)-10-oxapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaen-8-yl]benzo[e]benzimidazole |
|---|---|
| PubChem CID | 177303045 |
| Molecular Formula | C50H40N2O |
| Molecular Weight | 687.90 g/mol |
| Exact Mass | 687.33 |
| IUPAC Name | 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[5-(trideuteriomethyl)-10-oxapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaen-8-yl]benzo[e]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2nc3ccc4ccccc4c3n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2oc3cc4ccc5ccccc5c4cc3c12 |
| InChI | InChI=1S/C50H40N2O/c1-29(2)40-25-36(32-13-7-6-8-14-32)26-41(30(3)4)47(40)52-48-38-18-12-10-16-34(38)22-24-44(48)51-50(52)39-23-19-31(5)46-43-28-42-35(27-45(43)53-49(39)46)21-20-33-15-9-11-17-37(33)42/h6-30H,1-5H3/i5D3 |
| InChIKey | VQJQYOUBHJAKKK-VPYROQPTSA-N |
| XLogP | 14.27 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.90 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|