About CID 176753045
CID 176753045 (PubChem CID 176753045) has the molecular formula C45H30IrN4-2
and a molecular weight of 828.03 g/mol.
Molecular Properties
| Compound Name | CID 176753045 |
| PubChem CID | 176753045 |
| Molecular Formula | C45H30IrN4-2 |
| Molecular Weight | 828.03 g/mol |
| Exact Mass | 828.27 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cn2)cc1.[Ir].[c-]1cccc2c1c1nc3ccccc3n1c1cc3c4ccccc4n4c5ccccc5c(c21)c34 |
| InChI | InChI=1S/C31H16N3.C14H14N.Ir/c1-2-11-20-19(10-1)28-27(34-26-16-8-5-13-23(26)32-31(20)34)17-22-18-9-3-6-14-24(18)33-25-15-7-4-12-21(25)29(28)30(22)33;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h1-10,12-17H;4-6,8-9H,1-3H3;/q2*-1;/i;1D3,2D3,3D3; |
| InChIKey | IXHBFOAKQOBPJZ-YETZKOCPSA-N |
| XLogP | 11.22 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 828.03 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176753045 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176753045?
The IUPAC name of CID 176753045 (CID 176753045) is not available.
What is the SMILES notation for CID 176753045?
The canonical SMILES for CID 176753045 is [2H]C([2H])([2H])c1c[c-]c(-c2cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])cn2)cc1.[Ir].[c-]1cccc2c1c1nc3ccccc3n1c1cc3c4ccccc4n4c5ccccc5c(c21)c34.
What is the InChIKey of CID 176753045?
The InChIKey is IXHBFOAKQOBPJZ-YETZKOCPSA-N. The full InChI is InChI=1S/C31H16N3.C14H14N.Ir/c1-2-11-20-19(10-1)28-27(34-26-16-8-5-13-23(26)32-31(20)34)17-22-18-9-3-6-14-24(18)33-25-15-7-4-12-21(25)29(28)30(22)33;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h1-10,12-17H;4-6,8-9H,1-3H3;/q2*-1;/i;1D3,2D3,3D3;.
What are the key properties of CID 176753045?
CID 176753045 has a molecular weight of 828.03 g/mol, XLogP of 11.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176753045 is sourced from PubChem (CID 176753045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).