C50H44IrN2O-2 — CID 162454734
CID 162454734 (PubChem CID 162454734) has the molecular formula C50H44IrN2O-2 and a molecular weight of 893.21 g/mol.
| Compound Name | CID 162454734 |
|---|---|
| PubChem CID | 162454734 |
| Molecular Formula | C50H44IrN2O-2 |
| Molecular Weight | 893.21 g/mol |
| Exact Mass | 893.38 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[2H]C([2H])([2H])c1cnc2c3[c-]cccc3c3ccc4c5ccc(-c6c(C(C)C)cccc6C(C)C)cc5oc4c3c2c1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C37H32NO.C13H12N.Ir/c1-20(2)25-12-9-13-26(21(3)4)34(25)24-14-15-28-31-17-16-29-27-10-7-8-11-30(27)36-33(23(6)22(5)19-38-36)35(29)37(31)39-32(28)18-24;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h7-10,12-21H,1-6H3;3-6,8-9H,1-2H3;/q2*-1;/i5D3,6D3;1D3,2D3; |
| InChIKey | NWTXLTKNPMLTIX-FDBAHJKLSA-N |
| XLogP | 13.93 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.21 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|