C10H10IrN3- — CID 140884032
1,5-dimethyl-3-phenyl-1,2,4-triazole;iridium (PubChem CID 140884032) has the molecular formula C10H10IrN3- and a molecular weight of 364.43 g/mol. Its IUPAC name is 1,5-dimethyl-3-phenyl-1,2,4-triazole;iridium.
| Compound Name | 1,5-dimethyl-3-phenyl-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 140884032 |
| Molecular Formula | C10H10IrN3- |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 1,5-dimethyl-3-phenyl-1,2,4-triazole;iridium |
| SMILES | Cc1nc(-c2[c-]cccc2)nn1C.[Ir] |
| InChI | InChI=1S/C10H10N3.Ir/c1-8-11-10(12-13(8)2)9-6-4-3-5-7-9;/h3-6H,1-2H3;/q-1; |
| InChIKey | SOOQNDAKFPEWOL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|