C18H14IrN- — CID 58435059
iridium;2-methyl-3-phenyl-6-phenylpyridine (PubChem CID 58435059) has the molecular formula C18H14IrN- and a molecular weight of 436.53 g/mol. Its IUPAC name is iridium;2-methyl-3-phenyl-6-phenylpyridine.
| Compound Name | iridium;2-methyl-3-phenyl-6-phenylpyridine |
|---|---|
| PubChem CID | 58435059 |
| Molecular Formula | C18H14IrN- |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | iridium;2-methyl-3-phenyl-6-phenylpyridine |
| SMILES | Cc1nc(-c2[c-]cccc2)ccc1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C18H14N.Ir/c1-14-17(15-8-4-2-5-9-15)12-13-18(19-14)16-10-6-3-7-11-16;/h2-10,12-13H,1H3;/q-1; |
| InChIKey | DIBKOVXCSGZBOZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|