C41H41IrN5O-2 — CID 140687779
CID 140687779 (PubChem CID 140687779) has the molecular formula C41H41IrN5O-2 and a molecular weight of 812.03 g/mol.
| Compound Name | CID 140687779 |
|---|---|
| PubChem CID | 140687779 |
| Molecular Formula | C41H41IrN5O-2 |
| Molecular Weight | 812.03 g/mol |
| Exact Mass | 812.30 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2ccn3c4cc5c(cc4nc3c2[c-]n1)C(C)(C)C(C)(C)O5.Cc1cccc(C)c1-n1ccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C24H26N3O.C17H15N2.Ir/c1-22(2,3)20-10-14-8-9-27-18-12-19-16(23(4,5)24(6,7)28-19)11-17(18)26-21(27)15(14)13-25-20;1-13-7-6-8-14(2)16(13)19-12-11-18-17(19)15-9-4-3-5-10-15;/h8-12H,1-7H3;3-9,11-12H,1-2H3;/q2*-1; |
| InChIKey | XBOLIWLTOJBUTD-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.03 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|