C22H24IrN3- — CID 140687846
3,6-ditert-butyl-1H-benzimidazolo[2,1-a][2,7]naphthyridin-1-ide;iridium (PubChem CID 140687846) has the molecular formula C22H24IrN3- and a molecular weight of 522.67 g/mol. Its IUPAC name is 3,6-ditert-butyl-1H-benzimidazolo[2,1-a][2,7]naphthyridin-1-ide;iridium.
| Compound Name | 3,6-ditert-butyl-1H-benzimidazolo[2,1-a][2,7]naphthyridin-1-ide;iridium |
|---|---|
| PubChem CID | 140687846 |
| Molecular Formula | C22H24IrN3- |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 3,6-ditert-butyl-1H-benzimidazolo[2,1-a][2,7]naphthyridin-1-ide;iridium |
| SMILES | CC(C)(C)c1cc2cc(C(C)(C)C)n3c4ccccc4nc3c2[c-]n1.[Ir] |
| InChI | InChI=1S/C22H24N3.Ir/c1-21(2,3)18-11-14-12-19(22(4,5)6)25-17-10-8-7-9-16(17)24-20(25)15(14)13-23-18;/h7-12H,1-6H3;/q-1; |
| InChIKey | LGXIOXSESZMCSI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|