C28H40N3P — CID 144631358
3,6-ditert-butyl-1-methylbenzimidazolo[2,1-f][1,6]naphthyridine;ethane;ethyl(methylidene)phosphane (PubChem CID 144631358) has the molecular formula C28H40N3P and a molecular weight of 449.62 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-methylbenzimidazolo[2,1-f][1,6]naphthyridine;ethane;ethyl(methylidene)phosphane.
| Compound Name | 3,6-ditert-butyl-1-methylbenzimidazolo[2,1-f][1,6]naphthyridine;ethane;ethyl(methylidene)phosphane |
|---|---|
| PubChem CID | 144631358 |
| Molecular Formula | C28H40N3P |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 3,6-ditert-butyl-1-methylbenzimidazolo[2,1-f][1,6]naphthyridine;ethane;ethyl(methylidene)phosphane |
| SMILES | C=PCC.CC.Cc1cc(C(C)(C)C)nc2cc(C(C)(C)C)n3c4ccccc4nc3c12 |
| InChI | InChI=1S/C23H27N3.C3H7P.C2H6/c1-14-12-18(22(2,3)4)24-16-13-19(23(5,6)7)26-17-11-9-8-10-15(17)25-21(26)20(14)16;1-3-4-2;1-2/h8-13H,1-7H3;2-3H2,1H3;1-2H3 |
| InChIKey | GTSDJWYREMVOMH-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|