C18H17N3 — CID 70652136
3-tert-butylbenzimidazolo[2,1-f][1,6]naphthyridine (PubChem CID 70652136) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-tert-butylbenzimidazolo[2,1-f][1,6]naphthyridine.
| Compound Name | 3-tert-butylbenzimidazolo[2,1-f][1,6]naphthyridine |
|---|---|
| PubChem CID | 70652136 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-tert-butylbenzimidazolo[2,1-f][1,6]naphthyridine |
| SMILES | CC(C)(C)c1ccc2c(ccn3c4ccccc4nc23)n1 |
| InChI | InChI=1S/C18H17N3/c1-18(2,3)16-9-8-12-13(19-16)10-11-21-15-7-5-4-6-14(15)20-17(12)21/h4-11H,1-3H3 |
| InChIKey | AJTVQFOFEWKZQU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |