C25H32N4 — CID 140607275
6,9,14-tritert-butyl-8,10,13,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,8,11,13,15-octaene (PubChem CID 140607275) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is 6,9,14-tritert-butyl-8,10,13,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,8,11,13,15-octaene.
| Compound Name | 6,9,14-tritert-butyl-8,10,13,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,8,11,13,15-octaene |
|---|---|
| PubChem CID | 140607275 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 6,9,14-tritert-butyl-8,10,13,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,8,11,13,15-octaene |
| SMILES | CC(C)(C)c1cc2nc3c4cccc(C(C)(C)C)c4nc(C(C)(C)C)n3c2cn1 |
| InChI | InChI=1S/C25H32N4/c1-23(2,3)16-12-10-11-15-20(16)28-22(25(7,8)9)29-18-14-26-19(24(4,5)6)13-17(18)27-21(15)29/h10-14H,1-9H3 |
| InChIKey | DDBUAHIVUFAYPH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |