C25H24N4O — CID 123952986
9,14-ditert-butyl-22-oxa-6,10,13,15-tetrazahexacyclo[17.2.1.02,18.04,16.05,13.07,12]docosa-1,3,5,7,9,11,14,16,18,20-decaene (PubChem CID 123952986) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 9,14-ditert-butyl-22-oxa-6,10,13,15-tetrazahexacyclo[17.2.1.02,18.04,16.05,13.07,12]docosa-1,3,5,7,9,11,14,16,18,20-decaene.
| Compound Name | 9,14-ditert-butyl-22-oxa-6,10,13,15-tetrazahexacyclo[17.2.1.02,18.04,16.05,13.07,12]docosa-1,3,5,7,9,11,14,16,18,20-decaene |
|---|---|
| PubChem CID | 123952986 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 9,14-ditert-butyl-22-oxa-6,10,13,15-tetrazahexacyclo[17.2.1.02,18.04,16.05,13.07,12]docosa-1,3,5,7,9,11,14,16,18,20-decaene |
| SMILES | CC(C)(C)c1cc2nc3c4cc5c6ccc(o6)c5cc4nc(C(C)(C)C)n3c2cn1 |
| InChI | InChI=1S/C25H24N4O/c1-24(2,3)21-11-17-18(12-26-21)29-22(27-17)15-9-13-14(20-8-7-19(13)30-20)10-16(15)28-23(29)25(4,5)6/h7-12H,1-6H3 |
| InChIKey | LNQIXLPACPOMTP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|