C27H33N2+ — CID 123968217
9-tert-butyl-16,17-diethyl-16,17-dimethyl-8-aza-1-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-1(18),2,4,6,9,11(19),12,14-octaene (PubChem CID 123968217) has the molecular formula C27H33N2+ and a molecular weight of 385.58 g/mol. Its IUPAC name is 9-tert-butyl-16,17-diethyl-16,17-dimethyl-8-aza-1-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-1(18),2,4,6,9,11(19),12,14-octaene.
| Compound Name | 9-tert-butyl-16,17-diethyl-16,17-dimethyl-8-aza-1-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-1(18),2,4,6,9,11(19),12,14-octaene |
|---|---|
| PubChem CID | 123968217 |
| Molecular Formula | C27H33N2+ |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 9-tert-butyl-16,17-diethyl-16,17-dimethyl-8-aza-1-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-1(18),2,4,6,9,11(19),12,14-octaene |
| SMILES | CCC1(C)c2cccc3cc(C(C)(C)C)n4c5ccccc5[n+](c4c23)C1(C)CC |
| InChI | InChI=1S/C27H33N2/c1-8-26(6)19-14-12-13-18-17-22(25(3,4)5)28-20-15-10-11-16-21(20)29(24(28)23(18)19)27(26,7)9-2/h10-17H,8-9H2,1-7H3/q+1 |
| InChIKey | RFBPDNFJBNDPIA-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|