C22H27N2+ — CID 91254857
2,17-diethyl-1,2,17-trimethyl-16-aza-6-azoniapentacyclo[11.3.1.04,16.06,15.09,14]heptadeca-4,6(15),7,9(14),10,12-hexaene (PubChem CID 91254857) has the molecular formula C22H27N2+ and a molecular weight of 319.47 g/mol. Its IUPAC name is 2,17-diethyl-1,2,17-trimethyl-16-aza-6-azoniapentacyclo[11.3.1.04,16.06,15.09,14]heptadeca-4,6(15),7,9(14),10,12-hexaene.
| Compound Name | 2,17-diethyl-1,2,17-trimethyl-16-aza-6-azoniapentacyclo[11.3.1.04,16.06,15.09,14]heptadeca-4,6(15),7,9(14),10,12-hexaene |
|---|---|
| PubChem CID | 91254857 |
| Molecular Formula | C22H27N2+ |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | 2,17-diethyl-1,2,17-trimethyl-16-aza-6-azoniapentacyclo[11.3.1.04,16.06,15.09,14]heptadeca-4,6(15),7,9(14),10,12-hexaene |
| SMILES | CCC1(C)Cc2c[n+]3ccc4cccc5c4c3n2C1(C)C5(C)CC |
| InChI | InChI=1S/C22H27N2/c1-6-20(3)13-16-14-23-12-11-15-9-8-10-17-18(15)19(23)24(16)22(20,5)21(17,4)7-2/h8-12,14H,6-7,13H2,1-5H3/q+1 |
| InChIKey | FAPFRBZWZSYGIB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|