C11H15N — CID 125469342
(7S)-7-ethyl-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine (PubChem CID 125469342) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (7S)-7-ethyl-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine.
| Compound Name | (7S)-7-ethyl-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine |
|---|---|
| PubChem CID | 125469342 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (7S)-7-ethyl-7-methylbicyclo[4.2.0]octa-1(6),2,4-trien-2-amine |
| SMILES | CC[C@@]1(C)Cc2c(N)cccc21 |
| InChI | InChI=1S/C11H15N/c1-3-11(2)7-8-9(11)5-4-6-10(8)12/h4-6H,3,7,12H2,1-2H3/t11-/m0/s1 |
| InChIKey | CPLDNYKQTKIVDY-NSHDSACASA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|