C30H38N+ — CID 123702295
10,11-diethyl-3,6,10,11,17-pentamethyl-9-azoniahexacyclo[10.6.2.23,6.02,7.09,19.016,20]docosa-1,7,9(19),12,14,16(20),17-heptaene (PubChem CID 123702295) has the molecular formula C30H38N+ and a molecular weight of 412.64 g/mol. Its IUPAC name is 10,11-diethyl-3,6,10,11,17-pentamethyl-9-azoniahexacyclo[10.6.2.23,6.02,7.09,19.016,20]docosa-1,7,9(19),12,14,16(20),17-heptaene.
| Compound Name | 10,11-diethyl-3,6,10,11,17-pentamethyl-9-azoniahexacyclo[10.6.2.23,6.02,7.09,19.016,20]docosa-1,7,9(19),12,14,16(20),17-heptaene |
|---|---|
| PubChem CID | 123702295 |
| Molecular Formula | C30H38N+ |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 10,11-diethyl-3,6,10,11,17-pentamethyl-9-azoniahexacyclo[10.6.2.23,6.02,7.09,19.016,20]docosa-1,7,9(19),12,14,16(20),17-heptaene |
| SMILES | CCC1(C)c2cccc3c(C)cc4c5c(c[n+](c4c23)C1(C)CC)C1(C)CCC5(C)CC1 |
| InChI | InChI=1S/C30H38N/c1-8-29(6)22-12-10-11-20-19(3)17-21-25-23(27(4)13-15-28(25,5)16-14-27)18-31(26(21)24(20)22)30(29,7)9-2/h10-12,17-18H,8-9,13-16H2,1-7H3/q+1 |
| InChIKey | ZMMSCFYEKDYWDF-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|