C21H22 — CID 10956712
(17R)-17-ethyl-6,17-dimethyl-15,16-dihydrocyclopenta[a]phenanthrene (PubChem CID 10956712) has the molecular formula C21H22 and a molecular weight of 274.41 g/mol. Its IUPAC name is (17R)-17-ethyl-6,17-dimethyl-15,16-dihydrocyclopenta[a]phenanthrene.
| Compound Name | (17R)-17-ethyl-6,17-dimethyl-15,16-dihydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 10956712 |
| Molecular Formula | C21H22 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (17R)-17-ethyl-6,17-dimethyl-15,16-dihydrocyclopenta[a]phenanthrene |
| SMILES | CC[C@]1(C)CCc2c1ccc1c2cc(C)c2ccccc21 |
| InChI | InChI=1S/C21H22/c1-4-21(3)12-11-18-19-13-14(2)15-7-5-6-8-16(15)17(19)9-10-20(18)21/h5-10,13H,4,11-12H2,1-3H3/t21-/m1/s1 |
| InChIKey | DIDBUKLTPMLEAA-OAQYLSRUSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|