C27H34 — CID 101102026
17-[(2R)-5,6-dimethylheptan-2-yl]-17-methyl-15,16-dihydrocyclopenta[a]phenanthrene (PubChem CID 101102026) has the molecular formula C27H34 and a molecular weight of 358.57 g/mol. Its IUPAC name is 17-[(2R)-5,6-dimethylheptan-2-yl]-17-methyl-15,16-dihydrocyclopenta[a]phenanthrene.
| Compound Name | 17-[(2R)-5,6-dimethylheptan-2-yl]-17-methyl-15,16-dihydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 101102026 |
| Molecular Formula | C27H34 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 17-[(2R)-5,6-dimethylheptan-2-yl]-17-methyl-15,16-dihydrocyclopenta[a]phenanthrene |
| SMILES | CC(C)C(C)CC[C@@H](C)C1(C)CCc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C27H34/c1-18(2)19(3)10-11-20(4)27(5)17-16-25-24-13-12-21-8-6-7-9-22(21)23(24)14-15-26(25)27/h6-9,12-15,18-20H,10-11,16-17H2,1-5H3/t19?,20-,27?/m1/s1 |
| InChIKey | WWZKKWGSVQRSNC-AWGUXVRGSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|