C20H20 — CID 174256276
1,1-dimethyl-3,4-dihydro-2H-chrysene (PubChem CID 174256276) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-dihydro-2H-chrysene.
| Compound Name | 1,1-dimethyl-3,4-dihydro-2H-chrysene |
|---|---|
| PubChem CID | 174256276 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1,1-dimethyl-3,4-dihydro-2H-chrysene |
| SMILES | CC1(C)CCCc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C20H20/c1-20(2)13-5-8-18-17-10-9-14-6-3-4-7-15(14)16(17)11-12-19(18)20/h3-4,6-7,9-12H,5,8,13H2,1-2H3 |
| InChIKey | NMCWKADQMPBIBU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|