C18H18N2 — CID 174437347
3,4-dihydro-2H-chrysene-1,1-diamine (PubChem CID 174437347) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 3,4-dihydro-2H-chrysene-1,1-diamine.
| Compound Name | 3,4-dihydro-2H-chrysene-1,1-diamine |
|---|---|
| PubChem CID | 174437347 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3,4-dihydro-2H-chrysene-1,1-diamine |
| SMILES | NC1(N)CCCc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C18H18N2/c19-18(20)11-3-6-16-15-8-7-12-4-1-2-5-13(12)14(15)9-10-17(16)18/h1-2,4-5,7-10H,3,6,11,19-20H2 |
| InChIKey | UXQGXXXWZMZLIJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|