C33H37N2O+ — CID 123158587
1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-5,5-diethyl-6H-imidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123158587) has the molecular formula C33H37N2O+ and a molecular weight of 477.67 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-5,5-diethyl-6H-imidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-5,5-diethyl-6H-imidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123158587 |
| Molecular Formula | C33H37N2O+ |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-5,5-diethyl-6H-imidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CCC1(CC)Cc2ccccc2-c2n(-c3c(C(C)C)cc4c(oc5ccccc54)c3C(C)C)cc[n+]21 |
| InChI | InChI=1S/C33H37N2O/c1-7-33(8-2)20-23-13-9-10-14-24(23)32-34(17-18-35(32)33)30-26(21(3)4)19-27-25-15-11-12-16-28(25)36-31(27)29(30)22(5)6/h9-19,21-22H,7-8,20H2,1-6H3/q+1 |
| InChIKey | VPXWHPRBOLRUNM-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|