C32H28FN2+ — CID 123227534
1-(2,6-diphenyl-4-propan-2-ylphenyl)-8-fluoro-5,6-dihydroimidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123227534) has the molecular formula C32H28FN2+ and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-(2,6-diphenyl-4-propan-2-ylphenyl)-8-fluoro-5,6-dihydroimidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 1-(2,6-diphenyl-4-propan-2-ylphenyl)-8-fluoro-5,6-dihydroimidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123227534 |
| Molecular Formula | C32H28FN2+ |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-(2,6-diphenyl-4-propan-2-ylphenyl)-8-fluoro-5,6-dihydroimidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CC(C)c1cc(-c2ccccc2)c(-n2cc[n+]3c2-c2ccc(F)cc2CC3)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C32H28FN2/c1-22(2)26-20-29(23-9-5-3-6-10-23)31(30(21-26)24-11-7-4-8-12-24)35-18-17-34-16-15-25-19-27(33)13-14-28(25)32(34)35/h3-14,17-22H,15-16H2,1-2H3/q+1 |
| InChIKey | CCZRCVRFAQYQKS-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|