C29H27N2+ — CID 159085700
7,15-dimethyl-8-(2,3,5-trimethylphenyl)-2-aza-7-azoniapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14,16,18-nonaene (PubChem CID 159085700) has the molecular formula C29H27N2+ and a molecular weight of 403.55 g/mol. Its IUPAC name is 7,15-dimethyl-8-(2,3,5-trimethylphenyl)-2-aza-7-azoniapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14,16,18-nonaene.
| Compound Name | 7,15-dimethyl-8-(2,3,5-trimethylphenyl)-2-aza-7-azoniapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 159085700 |
| Molecular Formula | C29H27N2+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 7,15-dimethyl-8-(2,3,5-trimethylphenyl)-2-aza-7-azoniapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14,16,18-nonaene |
| SMILES | Cc1cc(C)c(C)c(-c2c3c(cc[n+]2C)-c2nc4c(cc2C3)-c2c(C)cccc2C4)c1 |
| InChI | InChI=1S/C29H27N2/c1-16-11-18(3)19(4)23(12-16)29-24-13-21-14-25-26(15-20-8-6-7-17(2)27(20)25)30-28(21)22(24)9-10-31(29)5/h6-12,14H,13,15H2,1-5H3/q+1 |
| InChIKey | BTWOPTAPMXXETP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|