C20H16FN — CID 148610022
2-(4,6-dimethyl-3H-inden-1-yl)-6-fluoroquinoline (PubChem CID 148610022) has the molecular formula C20H16FN and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-(4,6-dimethyl-3H-inden-1-yl)-6-fluoroquinoline.
| Compound Name | 2-(4,6-dimethyl-3H-inden-1-yl)-6-fluoroquinoline |
|---|---|
| PubChem CID | 148610022 |
| Molecular Formula | C20H16FN |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(4,6-dimethyl-3H-inden-1-yl)-6-fluoroquinoline |
| SMILES | Cc1cc(C)c2c(c1)C(c1ccc3cc(F)ccc3n1)=CC2 |
| InChI | InChI=1S/C20H16FN/c1-12-9-13(2)16-5-6-17(18(16)10-12)20-7-3-14-11-15(21)4-8-19(14)22-20/h3-4,6-11H,5H2,1-2H3 |
| InChIKey | NEELYGBSYPIFQK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |