C22H27N2+ — CID 169055457
1-methyl-5-(2-methylpropyl)-2-(2,3,5-trimethylphenyl)quinazolin-1-ium (PubChem CID 169055457) has the molecular formula C22H27N2+ and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-methyl-5-(2-methylpropyl)-2-(2,3,5-trimethylphenyl)quinazolin-1-ium.
| Compound Name | 1-methyl-5-(2-methylpropyl)-2-(2,3,5-trimethylphenyl)quinazolin-1-ium |
|---|---|
| PubChem CID | 169055457 |
| Molecular Formula | C22H27N2+ |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | 1-methyl-5-(2-methylpropyl)-2-(2,3,5-trimethylphenyl)quinazolin-1-ium |
| SMILES | Cc1cc(C)c(C)c(-c2ncc3c(CC(C)C)cccc3[n+]2C)c1 |
| InChI | InChI=1S/C22H27N2/c1-14(2)10-18-8-7-9-21-20(18)13-23-22(24(21)6)19-12-15(3)11-16(4)17(19)5/h7-9,11-14H,10H2,1-6H3/q+1 |
| InChIKey | RSBZJBQOTRIACY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|