C21H26N3+ — CID 123976540
1-methyl-7-(2-methylpropyl)-2-(2,3,5-trimethylphenyl)pyrido[2,3-b]pyrazin-1-ium (PubChem CID 123976540) has the molecular formula C21H26N3+ and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-methyl-7-(2-methylpropyl)-2-(2,3,5-trimethylphenyl)pyrido[2,3-b]pyrazin-1-ium.
| Compound Name | 1-methyl-7-(2-methylpropyl)-2-(2,3,5-trimethylphenyl)pyrido[2,3-b]pyrazin-1-ium |
|---|---|
| PubChem CID | 123976540 |
| Molecular Formula | C21H26N3+ |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-methyl-7-(2-methylpropyl)-2-(2,3,5-trimethylphenyl)pyrido[2,3-b]pyrazin-1-ium |
| SMILES | Cc1cc(C)c(C)c(-c2cnc3ncc(CC(C)C)cc3[n+]2C)c1 |
| InChI | InChI=1S/C21H26N3/c1-13(2)7-17-10-19-21(22-11-17)23-12-20(24(19)6)18-9-14(3)8-15(4)16(18)5/h8-13H,7H2,1-6H3/q+1 |
| InChIKey | WNVMSIZAKIVGOD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|