C22H25N — CID 147107503
6-(2-methylpropyl)-1-(2,3,5-trimethylphenyl)isoquinoline (PubChem CID 147107503) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 6-(2-methylpropyl)-1-(2,3,5-trimethylphenyl)isoquinoline.
| Compound Name | 6-(2-methylpropyl)-1-(2,3,5-trimethylphenyl)isoquinoline |
|---|---|
| PubChem CID | 147107503 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 6-(2-methylpropyl)-1-(2,3,5-trimethylphenyl)isoquinoline |
| SMILES | Cc1cc(C)c(C)c(-c2nccc3cc(CC(C)C)ccc23)c1 |
| InChI | InChI=1S/C22H25N/c1-14(2)10-18-6-7-20-19(13-18)8-9-23-22(20)21-12-15(3)11-16(4)17(21)5/h6-9,11-14H,10H2,1-5H3 |
| InChIKey | BLVSTMGNGDNGQY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |