C29H28FNO — CID 170219842
1-(8-fluoro-2-methyl-7-propan-2-yldibenzofuran-4-yl)-6-(2-methylpropyl)isoquinoline (PubChem CID 170219842) has the molecular formula C29H28FNO and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-(8-fluoro-2-methyl-7-propan-2-yldibenzofuran-4-yl)-6-(2-methylpropyl)isoquinoline.
| Compound Name | 1-(8-fluoro-2-methyl-7-propan-2-yldibenzofuran-4-yl)-6-(2-methylpropyl)isoquinoline |
|---|---|
| PubChem CID | 170219842 |
| Molecular Formula | C29H28FNO |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-(8-fluoro-2-methyl-7-propan-2-yldibenzofuran-4-yl)-6-(2-methylpropyl)isoquinoline |
| SMILES | Cc1cc(-c2nccc3cc(CC(C)C)ccc23)c2oc3cc(C(C)C)c(F)cc3c2c1 |
| InChI | InChI=1S/C29H28FNO/c1-16(2)10-19-6-7-21-20(13-19)8-9-31-28(21)25-12-18(5)11-24-23-14-26(30)22(17(3)4)15-27(23)32-29(24)25/h6-9,11-17H,10H2,1-5H3 |
| InChIKey | IEJHCHAEPDQNQF-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |