C21H23N — CID 130343559
6-propan-2-yl-1-(2,3,5-trimethylphenyl)isoquinoline (PubChem CID 130343559) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 6-propan-2-yl-1-(2,3,5-trimethylphenyl)isoquinoline.
| Compound Name | 6-propan-2-yl-1-(2,3,5-trimethylphenyl)isoquinoline |
|---|---|
| PubChem CID | 130343559 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 6-propan-2-yl-1-(2,3,5-trimethylphenyl)isoquinoline |
| SMILES | Cc1cc(C)c(C)c(-c2nccc3cc(C(C)C)ccc23)c1 |
| InChI | InChI=1S/C21H23N/c1-13(2)17-6-7-19-18(12-17)8-9-22-21(19)20-11-14(3)10-15(4)16(20)5/h6-13H,1-5H3 |
| InChIKey | YSJANCYJKAJRAR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |