About 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline
1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline (PubChem CID 166878735) has the molecular formula C21H22FN
and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline.
Molecular Properties
| Compound Name | 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline |
| PubChem CID | 166878735 |
| Molecular Formula | C21H22FN |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline |
| SMILES | Cc1cc(-c2nccc3ccc(C(C)C)cc23)c(C)c(C)c1F |
| InChI | InChI=1S/C21H22FN/c1-12(2)17-7-6-16-8-9-23-21(19(16)11-17)18-10-13(3)20(22)15(5)14(18)4/h6-12H,1-5H3 |
| InChIKey | BPDATHVRPOGWQN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline?
The IUPAC name of 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline (CID 166878735) is 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline.
What is the SMILES notation for 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline?
The canonical SMILES for 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline is Cc1cc(-c2nccc3ccc(C(C)C)cc23)c(C)c(C)c1F.
What is the InChIKey of 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline?
The InChIKey is BPDATHVRPOGWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN/c1-12(2)17-7-6-16-8-9-23-21(19(16)11-17)18-10-13(3)20(22)15(5)14(18)4/h6-12H,1-5H3.
What are the key properties of 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline?
1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline has a molecular weight of 307.41 g/mol, XLogP of 6.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-2,3,5-trimethylphenyl)-7-propan-2-ylisoquinoline is sourced from PubChem (CID 166878735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).