C23H28N+ — CID 159255688
2-[2,5-dimethyl-3-(trideuteriomethyl)phenyl]-1-methyl-7-(2-methylpropyl)quinolin-1-ium (PubChem CID 159255688) has the molecular formula C23H28N+ and a molecular weight of 321.50 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-(trideuteriomethyl)phenyl]-1-methyl-7-(2-methylpropyl)quinolin-1-ium.
| Compound Name | 2-[2,5-dimethyl-3-(trideuteriomethyl)phenyl]-1-methyl-7-(2-methylpropyl)quinolin-1-ium |
|---|---|
| PubChem CID | 159255688 |
| Molecular Formula | C23H28N+ |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 2-[2,5-dimethyl-3-(trideuteriomethyl)phenyl]-1-methyl-7-(2-methylpropyl)quinolin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)cc(-c2ccc3ccc(CC(C)C)cc3[n+]2C)c1C |
| InChI | InChI=1S/C23H28N/c1-15(2)11-19-7-8-20-9-10-22(24(6)23(20)14-19)21-13-16(3)12-17(4)18(21)5/h7-10,12-15H,11H2,1-6H3/q+1/i4D3 |
| InChIKey | AMVWSVUCRYPRMW-GKOSEXJESA-N |
| XLogP | 5.46 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|