C21H23FN+ — CID 157284589
2-[2,5-dimethyl-3-(trideuteriomethyl)phenyl]-6-fluoro-1,5,7-trimethylquinolin-1-ium (PubChem CID 157284589) has the molecular formula C21H23FN+ and a molecular weight of 311.44 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-(trideuteriomethyl)phenyl]-6-fluoro-1,5,7-trimethylquinolin-1-ium.
| Compound Name | 2-[2,5-dimethyl-3-(trideuteriomethyl)phenyl]-6-fluoro-1,5,7-trimethylquinolin-1-ium |
|---|---|
| PubChem CID | 157284589 |
| Molecular Formula | C21H23FN+ |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-[2,5-dimethyl-3-(trideuteriomethyl)phenyl]-6-fluoro-1,5,7-trimethylquinolin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)cc(-c2ccc3c(C)c(F)c(C)cc3[n+]2C)c1C |
| InChI | InChI=1S/C21H23FN/c1-12-9-13(2)15(4)18(10-12)19-8-7-17-16(5)21(22)14(3)11-20(17)23(19)6/h7-11H,1-6H3/q+1/i2D3 |
| InChIKey | YPIYFLKMGIEFQR-BMSJAHLVSA-N |
| XLogP | 5.01 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|