C24H26F4N+ — CID 153466973
4-fluoro-1-methyl-7-(3,3,3-trifluoro-2,2-dimethylpropyl)-2-(2,3,5-trimethylphenyl)quinolin-1-ium (PubChem CID 153466973) has the molecular formula C24H26F4N+ and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-fluoro-1-methyl-7-(3,3,3-trifluoro-2,2-dimethylpropyl)-2-(2,3,5-trimethylphenyl)quinolin-1-ium.
| Compound Name | 4-fluoro-1-methyl-7-(3,3,3-trifluoro-2,2-dimethylpropyl)-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
|---|---|
| PubChem CID | 153466973 |
| Molecular Formula | C24H26F4N+ |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 4-fluoro-1-methyl-7-(3,3,3-trifluoro-2,2-dimethylpropyl)-2-(2,3,5-trimethylphenyl)quinolin-1-ium |
| SMILES | Cc1cc(C)c(C)c(-c2cc(F)c3ccc(CC(C)(C)C(F)(F)F)cc3[n+]2C)c1 |
| InChI | InChI=1S/C24H26F4N/c1-14-9-15(2)16(3)19(10-14)22-12-20(25)18-8-7-17(11-21(18)29(22)6)13-23(4,5)24(26,27)28/h7-12H,13H2,1-6H3/q+1 |
| InChIKey | IRNVNBCJIPVTQN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|