C28H34N3+ — CID 123802828
3-[2,6-di(propan-2-yl)phenyl]-5-methyl-6-(2,3,5-trimethylphenyl)imidazo[4,5-c]pyridin-5-ium (PubChem CID 123802828) has the molecular formula C28H34N3+ and a molecular weight of 412.60 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-5-methyl-6-(2,3,5-trimethylphenyl)imidazo[4,5-c]pyridin-5-ium.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-5-methyl-6-(2,3,5-trimethylphenyl)imidazo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 123802828 |
| Molecular Formula | C28H34N3+ |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-5-methyl-6-(2,3,5-trimethylphenyl)imidazo[4,5-c]pyridin-5-ium |
| SMILES | Cc1cc(C)c(C)c(-c2cc3ncn(-c4c(C(C)C)cccc4C(C)C)c3c[n+]2C)c1 |
| InChI | InChI=1S/C28H34N3/c1-17(2)22-10-9-11-23(18(3)4)28(22)31-16-29-25-14-26(30(8)15-27(25)31)24-13-19(5)12-20(6)21(24)7/h9-18H,1-8H3/q+1 |
| InChIKey | CTIWDYMPHCSMFS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|