C19H24N3+ — CID 166501141
1-methyl-3-propan-2-yl-2-(2,3,5-trimethylphenyl)imidazo[4,5-b]pyridin-3-ium (PubChem CID 166501141) has the molecular formula C19H24N3+ and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-methyl-3-propan-2-yl-2-(2,3,5-trimethylphenyl)imidazo[4,5-b]pyridin-3-ium.
| Compound Name | 1-methyl-3-propan-2-yl-2-(2,3,5-trimethylphenyl)imidazo[4,5-b]pyridin-3-ium |
|---|---|
| PubChem CID | 166501141 |
| Molecular Formula | C19H24N3+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1-methyl-3-propan-2-yl-2-(2,3,5-trimethylphenyl)imidazo[4,5-b]pyridin-3-ium |
| SMILES | Cc1cc(C)c(C)c(-c2n(C)c3cccnc3[n+]2C(C)C)c1 |
| InChI | InChI=1S/C19H24N3/c1-12(2)22-18-17(8-7-9-20-18)21(6)19(22)16-11-13(3)10-14(4)15(16)5/h7-12H,1-6H3/q+1 |
| InChIKey | DXTDJYMTLUDLLT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|