C10H14N3+ — CID 158502094
3-ethyl-1,2-dimethylimidazo[4,5-b]pyridin-3-ium (PubChem CID 158502094) has the molecular formula C10H14N3+ and a molecular weight of 176.24 g/mol. Its IUPAC name is 3-ethyl-1,2-dimethylimidazo[4,5-b]pyridin-3-ium.
| Compound Name | 3-ethyl-1,2-dimethylimidazo[4,5-b]pyridin-3-ium |
|---|---|
| PubChem CID | 158502094 |
| Molecular Formula | C10H14N3+ |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-ethyl-1,2-dimethylimidazo[4,5-b]pyridin-3-ium |
| SMILES | CC[n+]1c(C)n(C)c2cccnc21 |
| InChI | InChI=1S/C10H14N3/c1-4-13-8(2)12(3)9-6-5-7-11-10(9)13/h5-7H,4H2,1-3H3/q+1 |
| InChIKey | IUGDRQIFZBPEGN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|