C14H14N2 — CID 171509495
5-ethyl-9-methylpyrido[3,2-b]indole (PubChem CID 171509495) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-ethyl-9-methylpyrido[3,2-b]indole.
| Compound Name | 5-ethyl-9-methylpyrido[3,2-b]indole |
|---|---|
| PubChem CID | 171509495 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5-ethyl-9-methylpyrido[3,2-b]indole |
| SMILES | CCn1c2cccnc2c2c(C)cccc21 |
| InChI | InChI=1S/C14H14N2/c1-3-16-11-7-4-6-10(2)13(11)14-12(16)8-5-9-15-14/h4-9H,3H2,1-2H3 |
| InChIKey | FSRZVGVDBPDZDN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |