C15H15N3O — CID 101205318
10-methyl-6-propylpyrido[3,2-c][1,6]naphthyridin-5-one (PubChem CID 101205318) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 10-methyl-6-propylpyrido[3,2-c][1,6]naphthyridin-5-one.
| Compound Name | 10-methyl-6-propylpyrido[3,2-c][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 101205318 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 10-methyl-6-propylpyrido[3,2-c][1,6]naphthyridin-5-one |
| SMILES | CCCn1c(=O)c2cccnc2c2c(C)nccc21 |
| InChI | InChI=1S/C15H15N3O/c1-3-9-18-12-6-8-16-10(2)13(12)14-11(15(18)19)5-4-7-17-14/h4-8H,3,9H2,1-2H3 |
| InChIKey | XVYPARQPUZHAHE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|