C13H16N2O — CID 150875994
1-butyl-2-methyl-1,8-naphthyridin-4-one (PubChem CID 150875994) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-butyl-2-methyl-1,8-naphthyridin-4-one.
| Compound Name | 1-butyl-2-methyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 150875994 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-butyl-2-methyl-1,8-naphthyridin-4-one |
| SMILES | CCCCn1c(C)cc(=O)c2cccnc21 |
| InChI | InChI=1S/C13H16N2O/c1-3-4-8-15-10(2)9-12(16)11-6-5-7-14-13(11)15/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | KVACIFUDRJONMB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |