C18H19N3O2 — CID 139946679
3-amino-1-butyl-4-(2-hydroxyphenyl)-1,8-naphthyridin-2-one (PubChem CID 139946679) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-amino-1-butyl-4-(2-hydroxyphenyl)-1,8-naphthyridin-2-one.
| Compound Name | 3-amino-1-butyl-4-(2-hydroxyphenyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 139946679 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-amino-1-butyl-4-(2-hydroxyphenyl)-1,8-naphthyridin-2-one |
| SMILES | CCCCn1c(=O)c(N)c(-c2ccccc2O)c2cccnc21 |
| InChI | InChI=1S/C18H19N3O2/c1-2-3-11-21-17-13(8-6-10-20-17)15(16(19)18(21)23)12-7-4-5-9-14(12)22/h4-10,22H,2-3,11,19H2,1H3 |
| InChIKey | YQRDEHUGWJTWRW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |