C14H12N2O — CID 84689140
2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)phenol (PubChem CID 84689140) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)phenol.
| Compound Name | 2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)phenol |
|---|---|
| PubChem CID | 84689140 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)phenol |
| SMILES | Cn1cc(-c2ccccc2O)c2cccnc21 |
| InChI | InChI=1S/C14H12N2O/c1-16-9-12(10-5-2-3-7-13(10)17)11-6-4-8-15-14(11)16/h2-9,17H,1H3 |
| InChIKey | VBDRFXCEKGIJJN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |