C10H13N3O — CID 82656231
2-amino-2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol (PubChem CID 82656231) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-amino-2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol.
| Compound Name | 2-amino-2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol |
|---|---|
| PubChem CID | 82656231 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-amino-2-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol |
| SMILES | Cn1cc(C(N)CO)c2cccnc21 |
| InChI | InChI=1S/C10H13N3O/c1-13-5-8(9(11)6-14)7-3-2-4-12-10(7)13/h2-5,9,14H,6,11H2,1H3 |
| InChIKey | NPZNZNNTBNJPFE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |