About (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol
(1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol (PubChem CID 96855329) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol.
Molecular Properties
| Compound Name | (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol |
| PubChem CID | 96855329 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol |
| SMILES | Cn1cc([C@H](O)CN)c2cccnc21 |
| InChI | InChI=1S/C10H13N3O/c1-13-6-8(9(14)5-11)7-3-2-4-12-10(7)13/h2-4,6,9,14H,5,11H2,1H3/t9-/m1/s1 |
| InChIKey | CLYYURQGXHABHZ-SECBINFHSA-N |
| XLogP | 0.57 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol?
The IUPAC name of (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol (CID 96855329) is (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol.
What is the SMILES notation for (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol?
The canonical SMILES for (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol is Cn1cc([C@H](O)CN)c2cccnc21.
What is the InChIKey of (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol?
The InChIKey is CLYYURQGXHABHZ-SECBINFHSA-N. The full InChI is InChI=1S/C10H13N3O/c1-13-6-8(9(14)5-11)7-3-2-4-12-10(7)13/h2-4,6,9,14H,5,11H2,1H3/t9-/m1/s1.
What are the key properties of (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol?
(1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol has a molecular weight of 191.23 g/mol, XLogP of 0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-amino-1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethanol is sourced from PubChem (CID 96855329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).