C10H13N3 — CID 174356978
N,N,1-trimethylpyrrolo[2,3-b]pyridin-3-amine (PubChem CID 174356978) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N,N,1-trimethylpyrrolo[2,3-b]pyridin-3-amine.
| Compound Name | N,N,1-trimethylpyrrolo[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 174356978 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N,N,1-trimethylpyrrolo[2,3-b]pyridin-3-amine |
| SMILES | CN(C)c1cn(C)c2ncccc12 |
| InChI | InChI=1S/C10H13N3/c1-12(2)9-7-13(3)10-8(9)5-4-6-11-10/h4-7H,1-3H3 |
| InChIKey | SGHUIQMNCJIPSJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |